C27H35ClFN3O4 — CID 67251310
2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethylcarbamic acid (PubChem CID 67251310) has the molecular formula C27H35ClFN3O4 and a molecular weight of 520.05 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethylcarbamic acid.
| Compound Name | 2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 67251310 |
| Molecular Formula | C27H35ClFN3O4 |
| Molecular Weight | 520.05 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 2-[(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethylcarbamic acid |
| SMILES | CNC(CNC(=O)c1cc(C(OCCNC(=O)O)c2cccc(Cl)c2)ccc1F)CC1CCCCC1 |
| InChI | InChI=1S/C27H35ClFN3O4/c1-30-22(14-18-6-3-2-4-7-18)17-32-26(33)23-16-20(10-11-24(23)29)25(36-13-12-31-27(34)35)19-8-5-9-21(28)15-19/h5,8-11,15-16,18,22,25,30-31H,2-4,6-7,12-14,17H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | NWAJRROZVDAIPP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|