C28H37ClFN3O4 — CID 59378372
methyl N-[2-[(R)-(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethyl]carbamate (PubChem CID 59378372) has the molecular formula C28H37ClFN3O4 and a molecular weight of 534.07 g/mol. Its IUPAC name is methyl N-[2-[(R)-(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 59378372 |
| Molecular Formula | C28H37ClFN3O4 |
| Molecular Weight | 534.07 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | methyl N-[2-[(R)-(3-chlorophenyl)-[3-[[3-cyclohexyl-2-(methylamino)propyl]carbamoyl]-4-fluorophenyl]methoxy]ethyl]carbamate |
| SMILES | CNC(CNC(=O)c1cc([C@@H](OCCNC(=O)OC)c2cccc(Cl)c2)ccc1F)CC1CCCCC1 |
| InChI | InChI=1S/C28H37ClFN3O4/c1-31-23(15-19-7-4-3-5-8-19)18-33-27(34)24-17-21(11-12-25(24)30)26(20-9-6-10-22(29)16-20)37-14-13-32-28(35)36-2/h6,9-12,16-17,19,23,26,31H,3-5,7-8,13-15,18H2,1-2H3,(H,32,35)(H,33,34)/t23?,26-/m0/s1 |
| InChIKey | IHNUMMOSEYXDRP-NASUQTAISA-N |
| XLogP | 5.23 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.07 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|