C18H17ClFNO5 — CID 59378371
5-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]-2-fluorobenzoic acid (PubChem CID 59378371) has the molecular formula C18H17ClFNO5 and a molecular weight of 381.79 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]-2-fluorobenzoic acid.
| Compound Name | 5-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 59378371 |
| Molecular Formula | C18H17ClFNO5 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 5-[(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]-2-fluorobenzoic acid |
| SMILES | COC(=O)NCCOC(c1cccc(Cl)c1)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H17ClFNO5/c1-25-18(24)21-7-8-26-16(11-3-2-4-13(19)9-11)12-5-6-15(20)14(10-12)17(22)23/h2-6,9-10,16H,7-8H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | RMTVHEBFDPJDJU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|