C18H17ClFNO4 — CID 58330079
5-[2-acetamidoethoxy-(3-chlorophenyl)methyl]-2-fluorobenzoic acid (PubChem CID 58330079) has the molecular formula C18H17ClFNO4 and a molecular weight of 365.79 g/mol. Its IUPAC name is 5-[2-acetamidoethoxy-(3-chlorophenyl)methyl]-2-fluorobenzoic acid.
| Compound Name | 5-[2-acetamidoethoxy-(3-chlorophenyl)methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 58330079 |
| Molecular Formula | C18H17ClFNO4 |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 5-[2-acetamidoethoxy-(3-chlorophenyl)methyl]-2-fluorobenzoic acid |
| SMILES | CC(=O)NCCOC(c1cccc(Cl)c1)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H17ClFNO4/c1-11(22)21-7-8-25-17(12-3-2-4-14(19)9-12)13-5-6-16(20)15(10-13)18(23)24/h2-6,9-10,17H,7-8H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | QIGXPKJJDNFEOW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|