C19H20LiNO5 — CID 68724058
lithium 3-[2-(methoxycarbonylamino)ethoxy-(4-methylphenyl)methyl]benzoate (PubChem CID 68724058) has the molecular formula C19H20LiNO5 and a molecular weight of 349.31 g/mol. Its IUPAC name is lithium 3-[2-(methoxycarbonylamino)ethoxy-(4-methylphenyl)methyl]benzoate.
| Compound Name | lithium 3-[2-(methoxycarbonylamino)ethoxy-(4-methylphenyl)methyl]benzoate |
|---|---|
| PubChem CID | 68724058 |
| Molecular Formula | C19H20LiNO5 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | lithium 3-[2-(methoxycarbonylamino)ethoxy-(4-methylphenyl)methyl]benzoate |
| SMILES | COC(=O)NCCOC(c1ccc(C)cc1)c1cccc(C(=O)[O-])c1.[Li+] |
| InChI | InChI=1S/C19H21NO5.Li/c1-13-6-8-14(9-7-13)17(25-11-10-20-19(23)24-2)15-4-3-5-16(12-15)18(21)22;/h3-9,12,17H,10-11H2,1-2H3,(H,20,23)(H,21,22);/q;+1/p-1 |
| InChIKey | LSVOCVLIZXHRPT-UHFFFAOYSA-M |
| XLogP | -1.18 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|