C29H41N3O5 — CID 143914772
methyl N-[2-[[2-methyl-5-[[(2S)-2-(methylamino)-3-[(3R)-oxan-3-yl]propyl]carbamoyl]phenyl]-(3-methylphenyl)methoxy]ethyl]carbamate (PubChem CID 143914772) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is methyl N-[2-[[2-methyl-5-[[(2S)-2-(methylamino)-3-[(3R)-oxan-3-yl]propyl]carbamoyl]phenyl]-(3-methylphenyl)methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[[2-methyl-5-[[(2S)-2-(methylamino)-3-[(3R)-oxan-3-yl]propyl]carbamoyl]phenyl]-(3-methylphenyl)methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 143914772 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | methyl N-[2-[[2-methyl-5-[[(2S)-2-(methylamino)-3-[(3R)-oxan-3-yl]propyl]carbamoyl]phenyl]-(3-methylphenyl)methoxy]ethyl]carbamate |
| SMILES | CN[C@H](CNC(=O)c1ccc(C)c(C(OCCNC(=O)OC)c2cccc(C)c2)c1)C[C@H]1CCCOC1 |
| InChI | InChI=1S/C29H41N3O5/c1-20-7-5-9-23(15-20)27(37-14-12-31-29(34)35-4)26-17-24(11-10-21(26)2)28(33)32-18-25(30-3)16-22-8-6-13-36-19-22/h5,7,9-11,15,17,22,25,27,30H,6,8,12-14,16,18-19H2,1-4H3,(H,31,34)(H,32,33)/t22-,25+,27?/m1/s1 |
| InChIKey | ZLIPVKVZNKXZEG-VHHDRZGZSA-N |
| XLogP | 3.90 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|