C54H62N2O6-2 — CID 21152509
bis(2-methyl-N-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]-1-phenylpropan-2-amine);oxalate (PubChem CID 21152509) has the molecular formula C54H62N2O6-2 and a molecular weight of 835.10 g/mol. Its IUPAC name is bis(2-methyl-N-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]-1-phenylpropan-2-amine);oxalate.
| Compound Name | bis(2-methyl-N-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]-1-phenylpropan-2-amine);oxalate |
|---|---|
| PubChem CID | 21152509 |
| Molecular Formula | C54H62N2O6-2 |
| Molecular Weight | 835.10 g/mol |
| Exact Mass | 834.46 |
| IUPAC Name | bis(2-methyl-N-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]-1-phenylpropan-2-amine);oxalate |
| SMILES | Cc1ccc(C(OCCNC(C)(C)Cc2ccccc2)c2ccccc2)cc1.Cc1ccc(C(OCCNC(C)(C)Cc2ccccc2)c2ccccc2)cc1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C26H31NO.C2H2O4/c2*1-21-14-16-24(17-15-21)25(23-12-8-5-9-13-23)28-19-18-27-26(2,3)20-22-10-6-4-7-11-22;3-1(4)2(5)6/h2*4-17,25,27H,18-20H2,1-3H3;(H,3,4)(H,5,6)/p-2 |
| InChIKey | OCYOKMYWMRSBLL-UHFFFAOYSA-L |
| XLogP | 7.91 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.10 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|