C18H23NO2 — CID 20838241
N,N-dimethyl-2-[(4-methylphenyl)-phenylmethoxy]ethanamine oxide (PubChem CID 20838241) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N,N-dimethyl-2-[(4-methylphenyl)-phenylmethoxy]ethanamine oxide.
| Compound Name | N,N-dimethyl-2-[(4-methylphenyl)-phenylmethoxy]ethanamine oxide |
|---|---|
| PubChem CID | 20838241 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N,N-dimethyl-2-[(4-methylphenyl)-phenylmethoxy]ethanamine oxide |
| SMILES | Cc1ccc(C(OCC[N+](C)(C)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-15-9-11-17(12-10-15)18(16-7-5-4-6-8-16)21-14-13-19(2,3)20/h4-12,18H,13-14H2,1-3H3 |
| InChIKey | SESJLJAGOXUKJZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|