C27H36ClN3O4 — CID 68726399
2-[(3-chlorophenyl)-[3-[cyclohexyl-[1-(methylamino)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid (PubChem CID 68726399) has the molecular formula C27H36ClN3O4 and a molecular weight of 502.06 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-[3-[cyclohexyl-[1-(methylamino)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid.
| Compound Name | 2-[(3-chlorophenyl)-[3-[cyclohexyl-[1-(methylamino)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 68726399 |
| Molecular Formula | C27H36ClN3O4 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 2-[(3-chlorophenyl)-[3-[cyclohexyl-[1-(methylamino)propan-2-yl]carbamoyl]phenyl]methoxy]ethylcarbamic acid |
| SMILES | CNCC(C)N(C(=O)c1cccc(C(OCCNC(=O)O)c2cccc(Cl)c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C27H36ClN3O4/c1-19(18-29-2)31(24-12-4-3-5-13-24)26(32)22-10-6-8-20(16-22)25(35-15-14-30-27(33)34)21-9-7-11-23(28)17-21/h6-11,16-17,19,24-25,29-30H,3-5,12-15,18H2,1-2H3,(H,33,34) |
| InChIKey | VNNHXCRHUQPORI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|