C29H42N2O2 — CID 67190814
N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-5-methoxy-1-phenylpentyl]benzamide (PubChem CID 67190814) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-5-methoxy-1-phenylpentyl]benzamide.
| Compound Name | N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-5-methoxy-1-phenylpentyl]benzamide |
|---|---|
| PubChem CID | 67190814 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | N-[1-cyclohexyl-3-(methylamino)propan-2-yl]-3-[(1S)-5-methoxy-1-phenylpentyl]benzamide |
| SMILES | CNCC(CC1CCCCC1)NC(=O)c1cccc([C@@H](CCCCOC)c2ccccc2)c1 |
| InChI | InChI=1S/C29H42N2O2/c1-30-22-27(20-23-12-5-3-6-13-23)31-29(32)26-17-11-16-25(21-26)28(18-9-10-19-33-2)24-14-7-4-8-15-24/h4,7-8,11,14-17,21,23,27-28,30H,3,5-6,9-10,12-13,18-20,22H2,1-2H3,(H,31,32)/t27?,28-/m0/s1 |
| InChIKey | WIGQQKHARIWVQT-CPRJBALCSA-N |
| XLogP | 5.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|