C34H51N3O3 — CID 143215164
(3Z,5E,7Z)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-7-[(S)-3-methoxypropoxy(phenyl)methyl]-2-methyl-1,2,8,9,10,10a-hexahydrocyclopenta[b]azonine-5-carboxamide (PubChem CID 143215164) has the molecular formula C34H51N3O3 and a molecular weight of 549.80 g/mol. Its IUPAC name is (3Z,5E,7Z)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-7-[(S)-3-methoxypropoxy(phenyl)methyl]-2-methyl-1,2,8,9,10,10a-hexahydrocyclopenta[b]azonine-5-carboxamide.
| Compound Name | (3Z,5E,7Z)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-7-[(S)-3-methoxypropoxy(phenyl)methyl]-2-methyl-1,2,8,9,10,10a-hexahydrocyclopenta[b]azonine-5-carboxamide |
|---|---|
| PubChem CID | 143215164 |
| Molecular Formula | C34H51N3O3 |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.39 |
| IUPAC Name | (3Z,5E,7Z)-N-[(2S)-1-cyclohexyl-3-(methylamino)propan-2-yl]-7-[(S)-3-methoxypropoxy(phenyl)methyl]-2-methyl-1,2,8,9,10,10a-hexahydrocyclopenta[b]azonine-5-carboxamide |
| SMILES | CNC[C@H](CC1CCCCC1)NC(=O)C1=C/C([C@@H](OCCCOC)c2ccccc2)=C2\CCCC2NC(C)\C=C\1 |
| InChI | InChI=1S/C34H51N3O3/c1-25-18-19-28(34(38)37-29(24-35-2)22-26-12-6-4-7-13-26)23-31(30-16-10-17-32(30)36-25)33(40-21-11-20-39-3)27-14-8-5-9-15-27/h5,8-9,14-15,18-19,23,25-26,29,32-33,35-36H,4,6-7,10-13,16-17,20-22,24H2,1-3H3,(H,37,38)/b19-18+,28-23+,31-30-/t25?,29-,32?,33-/m0/s1 |
| InChIKey | SVGCKKRJGZSSNP-BGRULTNISA-N |
| XLogP | 5.78 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|