C30H43NO3 — CID 58246655
(3R)-3-(cyclohexylmethyl)-1-[3-[(S)-3-ethoxypropoxy(phenyl)methyl]phenyl]-4-(methylamino)butan-1-one (PubChem CID 58246655) has the molecular formula C30H43NO3 and a molecular weight of 465.68 g/mol. Its IUPAC name is (3R)-3-(cyclohexylmethyl)-1-[3-[(S)-3-ethoxypropoxy(phenyl)methyl]phenyl]-4-(methylamino)butan-1-one.
| Compound Name | (3R)-3-(cyclohexylmethyl)-1-[3-[(S)-3-ethoxypropoxy(phenyl)methyl]phenyl]-4-(methylamino)butan-1-one |
|---|---|
| PubChem CID | 58246655 |
| Molecular Formula | C30H43NO3 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | (3R)-3-(cyclohexylmethyl)-1-[3-[(S)-3-ethoxypropoxy(phenyl)methyl]phenyl]-4-(methylamino)butan-1-one |
| SMILES | CCOCCCO[C@@H](c1ccccc1)c1cccc(C(=O)C[C@H](CNC)CC2CCCCC2)c1 |
| InChI | InChI=1S/C30H43NO3/c1-3-33-18-11-19-34-30(26-14-8-5-9-15-26)28-17-10-16-27(22-28)29(32)21-25(23-31-2)20-24-12-6-4-7-13-24/h5,8-10,14-17,22,24-25,30-31H,3-4,6-7,11-13,18-21,23H2,1-2H3/t25-,30+/m1/s1 |
| InChIKey | VUJFIINWSJNGBR-RNAHPLFWSA-N |
| XLogP | 6.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|