C23H39N3O4 — CID 10295753
N-[(2R)-1-cyclohexyl-3-[[(2R)-1-(methylamino)hexan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide (PubChem CID 10295753) has the molecular formula C23H39N3O4 and a molecular weight of 421.58 g/mol. Its IUPAC name is N-[(2R)-1-cyclohexyl-3-[[(2R)-1-(methylamino)hexan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[(2R)-1-cyclohexyl-3-[[(2R)-1-(methylamino)hexan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 10295753 |
| Molecular Formula | C23H39N3O4 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | N-[(2R)-1-cyclohexyl-3-[[(2R)-1-(methylamino)hexan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide |
| SMILES | CCCC[C@H](CNC)NC[C@@H](CC1CCCCC1)NC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C23H39N3O4/c1-3-4-10-18(14-24-2)25-15-19(11-16-8-6-5-7-9-16)26-23(30)17-12-20(27)22(29)21(28)13-17/h12-13,16,18-19,24-25,27-29H,3-11,14-15H2,1-2H3,(H,26,30)/t18-,19-/m1/s1 |
| InChIKey | JJDQVANDRIIYKH-RTBURBONSA-N |
| XLogP | 3.24 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|