C26H37N3O5 — CID 10162340
N-[(2R)-1-cyclohexyl-3-[[(2S)-1-(4-hydroxyphenyl)-3-(methylamino)propan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide (PubChem CID 10162340) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[(2R)-1-cyclohexyl-3-[[(2S)-1-(4-hydroxyphenyl)-3-(methylamino)propan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[(2R)-1-cyclohexyl-3-[[(2S)-1-(4-hydroxyphenyl)-3-(methylamino)propan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 10162340 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | N-[(2R)-1-cyclohexyl-3-[[(2S)-1-(4-hydroxyphenyl)-3-(methylamino)propan-2-yl]amino]propan-2-yl]-3,4,5-trihydroxybenzamide |
| SMILES | CNC[C@H](Cc1ccc(O)cc1)NC[C@@H](CC1CCCCC1)NC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C26H37N3O5/c1-27-15-20(11-18-7-9-22(30)10-8-18)28-16-21(12-17-5-3-2-4-6-17)29-26(34)19-13-23(31)25(33)24(32)14-19/h7-10,13-14,17,20-21,27-28,30-33H,2-6,11-12,15-16H2,1H3,(H,29,34)/t20-,21+/m0/s1 |
| InChIKey | OHXYAWXBFNSPKS-LEWJYISDSA-N |
| XLogP | 3.00 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|