C27H44N4O4 — CID 69470940
(2S)-3-cyclohexyl-2-N-[(E)-1-[(3R)-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-2-nitroethenyl]propane-1,2-diamine (PubChem CID 69470940) has the molecular formula C27H44N4O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is (2S)-3-cyclohexyl-2-N-[(E)-1-[(3R)-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-2-nitroethenyl]propane-1,2-diamine.
| Compound Name | (2S)-3-cyclohexyl-2-N-[(E)-1-[(3R)-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-2-nitroethenyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 69470940 |
| Molecular Formula | C27H44N4O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (2S)-3-cyclohexyl-2-N-[(E)-1-[(3R)-3-[(R)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-2-nitroethenyl]propane-1,2-diamine |
| SMILES | COCCCO[C@@H](c1ccccc1)[C@@H]1CCCN(/C(=C/[N+](=O)[O-])N[C@H](CN)CC2CCCCC2)C1 |
| InChI | InChI=1S/C27H44N4O4/c1-34-16-9-17-35-27(23-12-6-3-7-13-23)24-14-8-15-30(20-24)26(21-31(32)33)29-25(19-28)18-22-10-4-2-5-11-22/h3,6-7,12-13,21-22,24-25,27,29H,2,4-5,8-11,14-20,28H2,1H3/b26-21+/t24-,25+,27+/m1/s1 |
| InChIKey | BECATIPSEUWQOF-IOEOXKATSA-N |
| XLogP | 4.46 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|