C25H39FIN3O2 — CID 143215159
(3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-(4-fluorophenyl)-(3-iodopropoxy)methyl]piperidine-1-carboxamide (PubChem CID 143215159) has the molecular formula C25H39FIN3O2 and a molecular weight of 559.51 g/mol. Its IUPAC name is (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-(4-fluorophenyl)-(3-iodopropoxy)methyl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-(4-fluorophenyl)-(3-iodopropoxy)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 143215159 |
| Molecular Formula | C25H39FIN3O2 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | (3R)-N-[(2S)-1-amino-3-cyclohexylpropan-2-yl]-3-[(R)-(4-fluorophenyl)-(3-iodopropoxy)methyl]piperidine-1-carboxamide |
| SMILES | NC[C@H](CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@H](OCCCI)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H39FIN3O2/c26-22-11-9-20(10-12-22)24(32-15-5-13-27)21-8-4-14-30(18-21)25(31)29-23(17-28)16-19-6-2-1-3-7-19/h9-12,19,21,23-24H,1-8,13-18,28H2,(H,29,31)/t21-,23+,24+/m1/s1 |
| InChIKey | GHMAJHCLVVGIOH-NHTMILBNSA-N |
| XLogP | 5.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|