C26H42N2O3 — CID 68721259
3-amino-4-cyclohexyl-1-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]butan-2-one (PubChem CID 68721259) has the molecular formula C26H42N2O3 and a molecular weight of 430.63 g/mol. Its IUPAC name is 3-amino-4-cyclohexyl-1-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]butan-2-one.
| Compound Name | 3-amino-4-cyclohexyl-1-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]butan-2-one |
|---|---|
| PubChem CID | 68721259 |
| Molecular Formula | C26H42N2O3 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | 3-amino-4-cyclohexyl-1-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]butan-2-one |
| SMILES | COCCCOC(c1ccccc1)C1CCCN(CC(=O)C(N)CC2CCCCC2)C1 |
| InChI | InChI=1S/C26H42N2O3/c1-30-16-9-17-31-26(22-12-6-3-7-13-22)23-14-8-15-28(19-23)20-25(29)24(27)18-21-10-4-2-5-11-21/h3,6-7,12-13,21,23-24,26H,2,4-5,8-11,14-20,27H2,1H3 |
| InChIKey | LZAZDZZJZKQOKS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|