C30H43N3O6 — CID 87544837
[(2R)-3-cyclohexyl-2-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]carbamic acid (PubChem CID 87544837) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is [(2R)-3-cyclohexyl-2-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]carbamic acid.
| Compound Name | [(2R)-3-cyclohexyl-2-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]carbamic acid |
|---|---|
| PubChem CID | 87544837 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | [(2R)-3-cyclohexyl-2-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]carbamic acid |
| SMILES | COCCCOC(c1ccccc1)C1CCCN(c2c(N[C@@H](CNC(=O)O)CC3CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C30H43N3O6/c1-38-16-9-17-39-29(22-12-6-3-7-13-22)23-14-8-15-33(20-23)26-25(27(34)28(26)35)32-24(19-31-30(36)37)18-21-10-4-2-5-11-21/h3,6-7,12-13,21,23-24,29,31-32H,2,4-5,8-11,14-20H2,1H3,(H,36,37)/t23?,24-,29?/m1/s1 |
| InChIKey | OMPCEKUFSSWGRP-DJUMBFHZSA-N |
| XLogP | 4.31 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|