C35H55N3O6Si — CID 87303961
[3-cyclohexyl-2-[[2-[3-[(S)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]-(2-trimethylsilylethyl)carbamic acid (PubChem CID 87303961) has the molecular formula C35H55N3O6Si and a molecular weight of 641.93 g/mol. Its IUPAC name is [3-cyclohexyl-2-[[2-[3-[(S)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]-(2-trimethylsilylethyl)carbamic acid.
| Compound Name | [3-cyclohexyl-2-[[2-[3-[(S)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]-(2-trimethylsilylethyl)carbamic acid |
|---|---|
| PubChem CID | 87303961 |
| Molecular Formula | C35H55N3O6Si |
| Molecular Weight | 641.93 g/mol |
| Exact Mass | 641.39 |
| IUPAC Name | [3-cyclohexyl-2-[[2-[3-[(S)-3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]propyl]-(2-trimethylsilylethyl)carbamic acid |
| SMILES | COCCCO[C@H](c1ccccc1)C1CCCN(c2c(NC(CC3CCCCC3)CN(CC[Si](C)(C)C)C(=O)O)c(=O)c2=O)C1 |
| InChI | InChI=1S/C35H55N3O6Si/c1-43-20-12-21-44-34(27-15-9-6-10-16-27)28-17-11-18-37(24-28)31-30(32(39)33(31)40)36-29(23-26-13-7-5-8-14-26)25-38(35(41)42)19-22-45(2,3)4/h6,9-10,15-16,26,28-29,34,36H,5,7-8,11-14,17-25H2,1-4H3,(H,41,42)/t28?,29?,34-/m1/s1 |
| InChIKey | ZJYJEAJRMQLUAF-ONTVVTPSSA-N |
| XLogP | 6.36 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.93 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|