C35H53N3O7 — CID 87182500
[(3S)-4-(1-tert-butylcyclohexyl)-3-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]butyl]-hydroxycarbamic acid (PubChem CID 87182500) has the molecular formula C35H53N3O7 and a molecular weight of 627.82 g/mol. Its IUPAC name is [(3S)-4-(1-tert-butylcyclohexyl)-3-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]butyl]-hydroxycarbamic acid.
| Compound Name | [(3S)-4-(1-tert-butylcyclohexyl)-3-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]butyl]-hydroxycarbamic acid |
|---|---|
| PubChem CID | 87182500 |
| Molecular Formula | C35H53N3O7 |
| Molecular Weight | 627.82 g/mol |
| Exact Mass | 627.39 |
| IUPAC Name | [(3S)-4-(1-tert-butylcyclohexyl)-3-[[2-[3-[3-methoxypropoxy(phenyl)methyl]piperidin-1-yl]-3,4-dioxocyclobuten-1-yl]amino]butyl]-hydroxycarbamic acid |
| SMILES | COCCCOC(c1ccccc1)C1CCCN(c2c(N[C@H](CCN(O)C(=O)O)CC3(C(C)(C)C)CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C35H53N3O7/c1-34(2,3)35(17-9-6-10-18-35)23-27(16-20-38(43)33(41)42)36-28-29(31(40)30(28)39)37-19-11-15-26(24-37)32(45-22-12-21-44-4)25-13-7-5-8-14-25/h5,7-8,13-14,26-27,32,36,43H,6,9-12,15-24H2,1-4H3,(H,41,42)/t26?,27-,32?/m1/s1 |
| InChIKey | XTEDOHQDUCPZAV-OYUWRPJOSA-N |
| XLogP | 6.22 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|