C17H24ClNO3 — CID 87303059
(3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidine-1-carbonyl chloride (PubChem CID 87303059) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is (3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidine-1-carbonyl chloride.
| Compound Name | (3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidine-1-carbonyl chloride |
|---|---|
| PubChem CID | 87303059 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (3R)-3-[3-methoxypropoxy(phenyl)methyl]piperidine-1-carbonyl chloride |
| SMILES | COCCCOC(c1ccccc1)[C@@H]1CCCN(C(=O)Cl)C1 |
| InChI | InChI=1S/C17H24ClNO3/c1-21-11-6-12-22-16(14-7-3-2-4-8-14)15-9-5-10-19(13-15)17(18)20/h2-4,7-8,15-16H,5-6,9-13H2,1H3/t15-,16?/m1/s1 |
| InChIKey | JHXSDKCVHVDNFK-AAFJCEBUSA-N |
| XLogP | 3.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|