C22H33ClN2O5 — CID 68708683
tert-butyl 3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]azepane-1-carboxylate (PubChem CID 68708683) has the molecular formula C22H33ClN2O5 and a molecular weight of 440.97 g/mol. Its IUPAC name is tert-butyl 3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]azepane-1-carboxylate.
| Compound Name | tert-butyl 3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 68708683 |
| Molecular Formula | C22H33ClN2O5 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | tert-butyl 3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]azepane-1-carboxylate |
| SMILES | COC(=O)NCCO[C@@H](c1cccc(Cl)c1)C1CCCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H33ClN2O5/c1-22(2,3)30-21(27)25-12-6-5-8-17(15-25)19(16-9-7-10-18(23)14-16)29-13-11-24-20(26)28-4/h7,9-10,14,17,19H,5-6,8,11-13,15H2,1-4H3,(H,24,26)/t17?,19-/m0/s1 |
| InChIKey | QDANFCROKNOPAT-NNBQYGFHSA-N |
| XLogP | 4.79 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|