C20H29ClN2O6 — CID 66863138
tert-butyl 2-[(S)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]morpholine-4-carboxylate (PubChem CID 66863138) has the molecular formula C20H29ClN2O6 and a molecular weight of 428.91 g/mol. Its IUPAC name is tert-butyl 2-[(S)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[(S)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 66863138 |
| Molecular Formula | C20H29ClN2O6 |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl 2-[(S)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]morpholine-4-carboxylate |
| SMILES | COC(=O)NCCO[C@@H](c1cccc(Cl)c1)C1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C20H29ClN2O6/c1-20(2,3)29-19(25)23-9-11-27-16(13-23)17(14-6-5-7-15(21)12-14)28-10-8-22-18(24)26-4/h5-7,12,16-17H,8-11,13H2,1-4H3,(H,22,24)/t16?,17-/m0/s1 |
| InChIKey | QIJLDICVDVAADJ-DJNXLDHESA-N |
| XLogP | 3.39 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|