C24H31NO5 — CID 68544973
tert-butyl 2-[[2-(methoxymethyl)phenoxy]-phenylmethyl]morpholine-4-carboxylate (PubChem CID 68544973) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is tert-butyl 2-[[2-(methoxymethyl)phenoxy]-phenylmethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[[2-(methoxymethyl)phenoxy]-phenylmethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 68544973 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | tert-butyl 2-[[2-(methoxymethyl)phenoxy]-phenylmethyl]morpholine-4-carboxylate |
| SMILES | COCc1ccccc1OC(c1ccccc1)C1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C24H31NO5/c1-24(2,3)30-23(26)25-14-15-28-21(16-25)22(18-10-6-5-7-11-18)29-20-13-9-8-12-19(20)17-27-4/h5-13,21-22H,14-17H2,1-4H3 |
| InChIKey | GKDVNAKKIQKKHG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |