C22H27FINO5S — CID 87806374
tert-butyl 2-[(R)-[2-(2-fluoroethoxy)phenoxy]-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate (PubChem CID 87806374) has the molecular formula C22H27FINO5S and a molecular weight of 563.43 g/mol. Its IUPAC name is tert-butyl 2-[(R)-[2-(2-fluoroethoxy)phenoxy]-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[(R)-[2-(2-fluoroethoxy)phenoxy]-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 87806374 |
| Molecular Formula | C22H27FINO5S |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | tert-butyl 2-[(R)-[2-(2-fluoroethoxy)phenoxy]-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC([C@@H](Oc2ccccc2OCCF)c2ccc(I)s2)C1 |
| InChI | InChI=1S/C22H27FINO5S/c1-22(2,3)30-21(26)25-11-13-28-17(14-25)20(18-8-9-19(24)31-18)29-16-7-5-4-6-15(16)27-12-10-23/h4-9,17,20H,10-14H2,1-3H3/t17?,20-/m1/s1 |
| InChIKey | BOSPZYKBLJNJFR-UUSAFJCLSA-N |
| XLogP | 5.46 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|