C18H27ClN2O4 — CID 66861475
tert-butyl 2-[(S)-2-aminoethoxy-(3-chlorophenyl)methyl]morpholine-4-carboxylate (PubChem CID 66861475) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is tert-butyl 2-[(S)-2-aminoethoxy-(3-chlorophenyl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[(S)-2-aminoethoxy-(3-chlorophenyl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 66861475 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl 2-[(S)-2-aminoethoxy-(3-chlorophenyl)methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC([C@@H](OCCN)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H27ClN2O4/c1-18(2,3)25-17(22)21-8-10-23-15(12-21)16(24-9-7-20)13-5-4-6-14(19)11-13/h4-6,11,15-16H,7-10,12,20H2,1-3H3/t15?,16-/m0/s1 |
| InChIKey | MJFLHSWAMSAWKE-LYKKTTPLSA-N |
| XLogP | 2.99 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |