C15H19ClINO2 — CID 154662324
tert-butyl 3-[(3-chlorophenyl)-iodomethyl]azetidine-1-carboxylate (PubChem CID 154662324) has the molecular formula C15H19ClINO2 and a molecular weight of 407.68 g/mol. Its IUPAC name is tert-butyl 3-[(3-chlorophenyl)-iodomethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-chlorophenyl)-iodomethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 154662324 |
| Molecular Formula | C15H19ClINO2 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | tert-butyl 3-[(3-chlorophenyl)-iodomethyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(I)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C15H19ClINO2/c1-15(2,3)20-14(19)18-8-11(9-18)13(17)10-5-4-6-12(16)7-10/h4-7,11,13H,8-9H2,1-3H3 |
| InChIKey | GQAYRAUQOZROIO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|