C18H26ClNO2 — CID 143486993
tert-butyl 3-[1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate (PubChem CID 143486993) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is tert-butyl 3-[1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 143486993 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | tert-butyl 3-[1-(3-chlorophenyl)ethyl]piperidine-1-carboxylate |
| SMILES | CC(c1cccc(Cl)c1)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H26ClNO2/c1-13(14-7-5-9-16(19)11-14)15-8-6-10-20(12-15)17(21)22-18(2,3)4/h5,7,9,11,13,15H,6,8,10,12H2,1-4H3 |
| InChIKey | LETAQBCXBMGQDT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |