C16H22ClFN2O3 — CID 140626344
tert-butyl (2R)-2-[(R)-amino-(4-chloro-3-fluorophenyl)methyl]morpholine-4-carboxylate (PubChem CID 140626344) has the molecular formula C16H22ClFN2O3 and a molecular weight of 344.81 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(R)-amino-(4-chloro-3-fluorophenyl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(R)-amino-(4-chloro-3-fluorophenyl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 140626344 |
| Molecular Formula | C16H22ClFN2O3 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | tert-butyl (2R)-2-[(R)-amino-(4-chloro-3-fluorophenyl)methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H]([C@H](N)c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C16H22ClFN2O3/c1-16(2,3)23-15(21)20-6-7-22-13(9-20)14(19)10-4-5-11(17)12(18)8-10/h4-5,8,13-14H,6-7,9,19H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | DBGUROXVKXJCIO-ZIAGYGMSSA-N |
| XLogP | 3.11 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |