C14H20INO4S — CID 69405592
tert-butyl 2-[hydroxy-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate (PubChem CID 69405592) has the molecular formula C14H20INO4S and a molecular weight of 425.29 g/mol. Its IUPAC name is tert-butyl 2-[hydroxy-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[hydroxy-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 69405592 |
| Molecular Formula | C14H20INO4S |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | tert-butyl 2-[hydroxy-(5-iodothiophen-2-yl)methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C(O)c2ccc(I)s2)C1 |
| InChI | InChI=1S/C14H20INO4S/c1-14(2,3)20-13(18)16-6-7-19-9(8-16)12(17)10-4-5-11(15)21-10/h4-5,9,12,17H,6-8H2,1-3H3 |
| InChIKey | HIJUZTKQEMFGPL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|