C28H43ClN4O4 — CID 68714135
methyl N-[2-[(3-chlorophenyl)-[1-[(4-cyclohexylpiperidin-3-yl)carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate (PubChem CID 68714135) has the molecular formula C28H43ClN4O4 and a molecular weight of 535.13 g/mol. Its IUPAC name is methyl N-[2-[(3-chlorophenyl)-[1-[(4-cyclohexylpiperidin-3-yl)carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(3-chlorophenyl)-[1-[(4-cyclohexylpiperidin-3-yl)carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 68714135 |
| Molecular Formula | C28H43ClN4O4 |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | methyl N-[2-[(3-chlorophenyl)-[1-[(4-cyclohexylpiperidin-3-yl)carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCOC(c1cccc(Cl)c1)C1CCCN(C(=O)NC2CNCCC2C2CCCCC2)C1 |
| InChI | InChI=1S/C28H43ClN4O4/c1-36-28(35)31-14-16-37-26(21-9-5-11-23(29)17-21)22-10-6-15-33(19-22)27(34)32-25-18-30-13-12-24(25)20-7-3-2-4-8-20/h5,9,11,17,20,22,24-26,30H,2-4,6-8,10,12-16,18-19H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | GHOYPWNDZYIDLY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|