C34H46ClN3O7 — CID 59411489
benzyl (3S,4R)-3-[(3R)-3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carbonyl]oxy-4-(2-methylpropyl)piperidine-1-carboxylate (PubChem CID 59411489) has the molecular formula C34H46ClN3O7 and a molecular weight of 644.21 g/mol. Its IUPAC name is benzyl (3S,4R)-3-[(3R)-3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carbonyl]oxy-4-(2-methylpropyl)piperidine-1-carboxylate.
| Compound Name | benzyl (3S,4R)-3-[(3R)-3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carbonyl]oxy-4-(2-methylpropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59411489 |
| Molecular Formula | C34H46ClN3O7 |
| Molecular Weight | 644.21 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | benzyl (3S,4R)-3-[(3R)-3-[(R)-(3-chlorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carbonyl]oxy-4-(2-methylpropyl)piperidine-1-carboxylate |
| SMILES | COC(=O)NCCO[C@@H](c1cccc(Cl)c1)[C@@H]1CCCN(C(=O)O[C@@H]2CN(C(=O)OCc3ccccc3)CC[C@H]2CC(C)C)C1 |
| InChI | InChI=1S/C34H46ClN3O7/c1-24(2)19-26-14-17-38(33(40)44-23-25-9-5-4-6-10-25)22-30(26)45-34(41)37-16-8-12-28(21-37)31(27-11-7-13-29(35)20-27)43-18-15-36-32(39)42-3/h4-7,9-11,13,20,24,26,28,30-31H,8,12,14-19,21-23H2,1-3H3,(H,36,39)/t26-,28+,30+,31-/m0/s1 |
| InChIKey | BWXABXONNQWFLP-IVAGLTONSA-N |
| XLogP | 6.68 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.21 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|