C19H28ClFN2O3 — CID 69262349
butyl 3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylate (PubChem CID 69262349) has the molecular formula C19H28ClFN2O3 and a molecular weight of 386.90 g/mol. Its IUPAC name is butyl 3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylate.
| Compound Name | butyl 3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 69262349 |
| Molecular Formula | C19H28ClFN2O3 |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | butyl 3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC([C@@H](OCCN)c2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C19H28ClFN2O3/c1-2-3-8-26-19(24)23-7-4-5-14(13-23)18(25-9-6-22)15-10-16(20)12-17(21)11-15/h10-12,14,18H,2-9,13,22H2,1H3/t14?,18-/m1/s1 |
| InChIKey | CXTDNGUQRJIRSQ-XPKAQORNSA-N |
| XLogP | 4.14 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|