C17H22F2N2O5 — CID 69262213
3-[(3,5-difluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylic acid (PubChem CID 69262213) has the molecular formula C17H22F2N2O5 and a molecular weight of 372.37 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(3,5-difluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69262213 |
| Molecular Formula | C17H22F2N2O5 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[(3,5-difluorophenyl)-[2-(methoxycarbonylamino)ethoxy]methyl]piperidine-1-carboxylic acid |
| SMILES | COC(=O)NCCOC(c1cc(F)cc(F)c1)C1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C17H22F2N2O5/c1-25-16(22)20-4-6-26-15(12-7-13(18)9-14(19)8-12)11-3-2-5-21(10-11)17(23)24/h7-9,11,15H,2-6,10H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | LGRLSTGKZBXURS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|