C22H35FN4O4 — CID 68712849
methyl N-[2-[(R)-[(3R)-1-[ethylamino(propan-2-yl)carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate (PubChem CID 68712849) has the molecular formula C22H35FN4O4 and a molecular weight of 438.54 g/mol. Its IUPAC name is methyl N-[2-[(R)-[(3R)-1-[ethylamino(propan-2-yl)carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-[(3R)-1-[ethylamino(propan-2-yl)carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 68712849 |
| Molecular Formula | C22H35FN4O4 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | methyl N-[2-[(R)-[(3R)-1-[ethylamino(propan-2-yl)carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate |
| SMILES | CCNN(C(=O)N1CCC[C@@H]([C@@H](OCCNC(=O)OC)c2cccc(F)c2)C1)C(C)C |
| InChI | InChI=1S/C22H35FN4O4/c1-5-25-27(16(2)3)22(29)26-12-7-9-18(15-26)20(17-8-6-10-19(23)14-17)31-13-11-24-21(28)30-4/h6,8,10,14,16,18,20,25H,5,7,9,11-13,15H2,1-4H3,(H,24,28)/t18-,20+/m1/s1 |
| InChIKey | TXLLGNPNSIOVOR-QUCCMNQESA-N |
| XLogP | 3.31 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|