C32H53FN4O7Si — CID 87372513
methyl N-[2-[(3-fluorophenyl)-[(3R)-1-[[(2S)-1-[formyl(2-trimethylsilylpropoxy)amino]-3-(oxan-3-yl)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate (PubChem CID 87372513) has the molecular formula C32H53FN4O7Si and a molecular weight of 652.88 g/mol. Its IUPAC name is methyl N-[2-[(3-fluorophenyl)-[(3R)-1-[[(2S)-1-[formyl(2-trimethylsilylpropoxy)amino]-3-(oxan-3-yl)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(3-fluorophenyl)-[(3R)-1-[[(2S)-1-[formyl(2-trimethylsilylpropoxy)amino]-3-(oxan-3-yl)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 87372513 |
| Molecular Formula | C32H53FN4O7Si |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | methyl N-[2-[(3-fluorophenyl)-[(3R)-1-[[(2S)-1-[formyl(2-trimethylsilylpropoxy)amino]-3-(oxan-3-yl)propan-2-yl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
| SMILES | COC(=O)NCCOC(c1cccc(F)c1)[C@@H]1CCCN(C(=O)N[C@@H](CC2CCCOC2)CN(C=O)OCC(C)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C32H53FN4O7Si/c1-24(45(3,4)5)21-44-37(23-38)20-29(17-25-9-8-15-42-22-25)35-31(39)36-14-7-11-27(19-36)30(26-10-6-12-28(33)18-26)43-16-13-34-32(40)41-2/h6,10,12,18,23-25,27,29-30H,7-9,11,13-17,19-22H2,1-5H3,(H,34,40)(H,35,39)/t24?,25?,27-,29+,30?/m1/s1 |
| InChIKey | QEMSJCOPDMNZOD-DYXGBEPXSA-N |
| XLogP | 4.96 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|