C15H20ClFN2O3 — CID 69266324
3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylic acid (PubChem CID 69266324) has the molecular formula C15H20ClFN2O3 and a molecular weight of 330.79 g/mol. Its IUPAC name is 3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69266324 |
| Molecular Formula | C15H20ClFN2O3 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 3-[(R)-2-aminoethoxy-(3-chloro-5-fluorophenyl)methyl]piperidine-1-carboxylic acid |
| SMILES | NCCO[C@@H](c1cc(F)cc(Cl)c1)C1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C15H20ClFN2O3/c16-12-6-11(7-13(17)8-12)14(22-5-3-18)10-2-1-4-19(9-10)15(20)21/h6-8,10,14H,1-5,9,18H2,(H,20,21)/t10?,14-/m1/s1 |
| InChIKey | GDVSLZANUDJWIJ-LNUXAPHWSA-N |
| XLogP | 2.89 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |