C26H40ClFN4O5 — CID 68954316
methyl N-[2-[(R)-(3-chloro-5-fluorophenyl)-[1-[methylamino-[3-(oxan-3-yl)propyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate (PubChem CID 68954316) has the molecular formula C26H40ClFN4O5 and a molecular weight of 543.08 g/mol. Its IUPAC name is methyl N-[2-[(R)-(3-chloro-5-fluorophenyl)-[1-[methylamino-[3-(oxan-3-yl)propyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-(3-chloro-5-fluorophenyl)-[1-[methylamino-[3-(oxan-3-yl)propyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 68954316 |
| Molecular Formula | C26H40ClFN4O5 |
| Molecular Weight | 543.08 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | methyl N-[2-[(R)-(3-chloro-5-fluorophenyl)-[1-[methylamino-[3-(oxan-3-yl)propyl]carbamoyl]piperidin-3-yl]methoxy]ethyl]carbamate |
| SMILES | CNN(CCCC1CCCOC1)C(=O)N1CCCC([C@@H](OCCNC(=O)OC)c2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C26H40ClFN4O5/c1-29-32(11-3-6-19-7-5-12-36-18-19)26(34)31-10-4-8-20(17-31)24(37-13-9-30-25(33)35-2)21-14-22(27)16-23(28)15-21/h14-16,19-20,24,29H,3-13,17-18H2,1-2H3,(H,30,33)/t19?,20?,24-/m1/s1 |
| InChIKey | QFKIPIZDOQYSAU-ZSHKSDETSA-N |
| XLogP | 4.37 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.08 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|