C18H24ClN5O3 — CID 141177743
3-[(R)-(3-chlorophenyl)-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethoxy]methyl]piperidine-1-carboxylic acid (PubChem CID 141177743) has the molecular formula C18H24ClN5O3 and a molecular weight of 393.88 g/mol. Its IUPAC name is 3-[(R)-(3-chlorophenyl)-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethoxy]methyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[(R)-(3-chlorophenyl)-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethoxy]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141177743 |
| Molecular Formula | C18H24ClN5O3 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-[(R)-(3-chlorophenyl)-[2-[(N-cyano-N'-methylcarbamimidoyl)amino]ethoxy]methyl]piperidine-1-carboxylic acid |
| SMILES | C/N=C(\NC#N)NCCO[C@@H](c1cccc(Cl)c1)C1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C18H24ClN5O3/c1-21-17(23-12-20)22-7-9-27-16(13-4-2-6-15(19)10-13)14-5-3-8-24(11-14)18(25)26/h2,4,6,10,14,16H,3,5,7-9,11H2,1H3,(H,25,26)(H2,21,22,23)/t14?,16-/m0/s1 |
| InChIKey | XRHMZDNQVJPLLQ-WMCAAGNKSA-N |
| XLogP | 2.43 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|