C24H29F2NO4 — CID 87647581
(2R)-2-[(1R)-1-[3-fluoro-2-(4-fluoro-3-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde (PubChem CID 87647581) has the molecular formula C24H29F2NO4 and a molecular weight of 433.50 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-[3-fluoro-2-(4-fluoro-3-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde.
| Compound Name | (2R)-2-[(1R)-1-[3-fluoro-2-(4-fluoro-3-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 87647581 |
| Molecular Formula | C24H29F2NO4 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (2R)-2-[(1R)-1-[3-fluoro-2-(4-fluoro-3-methylphenyl)phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
| SMILES | COCCCC[C@@](O)(c1cccc(F)c1-c1ccc(F)c(C)c1)[C@H]1CN(C=O)CCO1 |
| InChI | InChI=1S/C24H29F2NO4/c1-17-14-18(8-9-20(17)25)23-19(6-5-7-21(23)26)24(29,10-3-4-12-30-2)22-15-27(16-28)11-13-31-22/h5-9,14,16,22,29H,3-4,10-13,15H2,1-2H3/t22-,24-/m1/s1 |
| InChIKey | LFRXQMXBJKBGMO-ISKFKSNPSA-N |
| XLogP | 3.80 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|