C26H29ClN2O4 — CID 87647015
(2R)-2-[(1R)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde (PubChem CID 87647015) has the molecular formula C26H29ClN2O4 and a molecular weight of 468.98 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde.
| Compound Name | (2R)-2-[(1R)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 87647015 |
| Molecular Formula | C26H29ClN2O4 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (2R)-2-[(1R)-1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
| SMILES | COCCCC[C@@](O)(c1cccc(Cl)c1-c1cnc2ccccc2c1)[C@H]1CN(C=O)CCO1 |
| InChI | InChI=1S/C26H29ClN2O4/c1-32-13-5-4-11-26(31,24-17-29(18-30)12-14-33-24)21-8-6-9-22(27)25(21)20-15-19-7-2-3-10-23(19)28-16-20/h2-3,6-10,15-16,18,24,31H,4-5,11-14,17H2,1H3/t24-,26-/m1/s1 |
| InChIKey | WFJCOJDVTCJXTF-AOYPEHQESA-N |
| XLogP | 4.42 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|