C22H27Cl2NO3 — CID 68691607
1-[3-chloro-2-(3-chlorophenyl)phenyl]-5-methoxy-1-[(2R)-morpholin-2-yl]pentan-1-ol (PubChem CID 68691607) has the molecular formula C22H27Cl2NO3 and a molecular weight of 424.37 g/mol. Its IUPAC name is 1-[3-chloro-2-(3-chlorophenyl)phenyl]-5-methoxy-1-[(2R)-morpholin-2-yl]pentan-1-ol.
| Compound Name | 1-[3-chloro-2-(3-chlorophenyl)phenyl]-5-methoxy-1-[(2R)-morpholin-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 68691607 |
| Molecular Formula | C22H27Cl2NO3 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 1-[3-chloro-2-(3-chlorophenyl)phenyl]-5-methoxy-1-[(2R)-morpholin-2-yl]pentan-1-ol |
| SMILES | COCCCCC(O)(c1cccc(Cl)c1-c1cccc(Cl)c1)C1CNCCO1 |
| InChI | InChI=1S/C22H27Cl2NO3/c1-27-12-3-2-10-22(26,20-15-25-11-13-28-20)18-8-5-9-19(24)21(18)16-6-4-7-17(23)14-16/h4-9,14,20,25-26H,2-3,10-13,15H2,1H3 |
| InChIKey | LHDBLQIOSXDAIE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|