C33H36ClN3O4 — CID 68994007
[4-(aminomethyl)phenyl]-[2-[1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholin-4-yl]methanone (PubChem CID 68994007) has the molecular formula C33H36ClN3O4 and a molecular weight of 574.12 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]-[2-[1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholin-4-yl]methanone.
| Compound Name | [4-(aminomethyl)phenyl]-[2-[1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 68994007 |
| Molecular Formula | C33H36ClN3O4 |
| Molecular Weight | 574.12 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | [4-(aminomethyl)phenyl]-[2-[1-(3-chloro-2-quinolin-3-ylphenyl)-1-hydroxy-5-methoxypentyl]morpholin-4-yl]methanone |
| SMILES | COCCCCC(O)(c1cccc(Cl)c1-c1cnc2ccccc2c1)C1CN(C(=O)c2ccc(CN)cc2)CCO1 |
| InChI | InChI=1S/C33H36ClN3O4/c1-40-17-5-4-15-33(39,30-22-37(16-18-41-30)32(38)24-13-11-23(20-35)12-14-24)27-8-6-9-28(34)31(27)26-19-25-7-2-3-10-29(25)36-21-26/h2-3,6-14,19,21,30,39H,4-5,15-18,20,22,35H2,1H3 |
| InChIKey | HLVNRCAADOEIME-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.12 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|