C25H32ClNO5 — CID 87648135
(2R)-2-[(1R)-1-[3-chloro-2-[3-(methoxymethyl)phenyl]phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde (PubChem CID 87648135) has the molecular formula C25H32ClNO5 and a molecular weight of 461.99 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-[3-chloro-2-[3-(methoxymethyl)phenyl]phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde.
| Compound Name | (2R)-2-[(1R)-1-[3-chloro-2-[3-(methoxymethyl)phenyl]phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 87648135 |
| Molecular Formula | C25H32ClNO5 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (2R)-2-[(1R)-1-[3-chloro-2-[3-(methoxymethyl)phenyl]phenyl]-1-hydroxy-5-methoxypentyl]morpholine-4-carbaldehyde |
| SMILES | COCCCC[C@@](O)(c1cccc(Cl)c1-c1cccc(COC)c1)[C@H]1CN(C=O)CCO1 |
| InChI | InChI=1S/C25H32ClNO5/c1-30-13-4-3-11-25(29,23-16-27(18-28)12-14-32-23)21-9-6-10-22(26)24(21)20-8-5-7-19(15-20)17-31-2/h5-10,15,18,23,29H,3-4,11-14,16-17H2,1-2H3/t23-,25-/m1/s1 |
| InChIKey | LATFMCIGCIAOAM-ILBGXUMGSA-N |
| XLogP | 4.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|