C28H36ClNO4 — CID 163788140
tert-butyl (2R)-2-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxypent-4-enyl]morpholine-4-carboxylate (PubChem CID 163788140) has the molecular formula C28H36ClNO4 and a molecular weight of 486.05 g/mol. Its IUPAC name is tert-butyl (2R)-2-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxypent-4-enyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxypent-4-enyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 163788140 |
| Molecular Formula | C28H36ClNO4 |
| Molecular Weight | 486.05 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | tert-butyl (2R)-2-[1-[3-chloro-2-(3-ethylphenyl)phenyl]-1-hydroxypent-4-enyl]morpholine-4-carboxylate |
| SMILES | C=CCCC(O)(c1cccc(Cl)c1-c1cccc(CC)c1)[C@H]1CN(C(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C28H36ClNO4/c1-6-8-15-28(32,24-19-30(16-17-33-24)26(31)34-27(3,4)5)22-13-10-14-23(29)25(22)21-12-9-11-20(7-2)18-21/h6,9-14,18,24,32H,1,7-8,15-17,19H2,2-5H3/t24-,28?/m1/s1 |
| InChIKey | MUIKOESNOXQWCA-RIBGEGAISA-N |
| XLogP | 6.36 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.05 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|