C23H26FNO5 — CID 87444114
(2R)-2-[(1S)-1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxy-4-oxobutyl]morpholine-4-carboxylic acid (PubChem CID 87444114) has the molecular formula C23H26FNO5 and a molecular weight of 415.46 g/mol. Its IUPAC name is (2R)-2-[(1S)-1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxy-4-oxobutyl]morpholine-4-carboxylic acid.
| Compound Name | (2R)-2-[(1S)-1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxy-4-oxobutyl]morpholine-4-carboxylic acid |
|---|---|
| PubChem CID | 87444114 |
| Molecular Formula | C23H26FNO5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (2R)-2-[(1S)-1-[2-(3-ethylphenyl)-3-fluorophenyl]-1-hydroxy-4-oxobutyl]morpholine-4-carboxylic acid |
| SMILES | CCc1cccc(-c2c(F)cccc2[C@@](O)(CCC=O)[C@H]2CN(C(=O)O)CCO2)c1 |
| InChI | InChI=1S/C23H26FNO5/c1-2-16-6-3-7-17(14-16)21-18(8-4-9-19(21)24)23(29,10-5-12-26)20-15-25(22(27)28)11-13-30-20/h3-4,6-9,12,14,20,29H,2,5,10-11,13,15H2,1H3,(H,27,28)/t20-,23+/m1/s1 |
| InChIKey | UGGYRZRMQYWZKT-OFNKIYASSA-N |
| XLogP | 3.60 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|