C23H30FNO3 — CID 69171937
1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-morpholin-2-ylpentan-1-ol (PubChem CID 69171937) has the molecular formula C23H30FNO3 and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-morpholin-2-ylpentan-1-ol.
| Compound Name | 1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-morpholin-2-ylpentan-1-ol |
|---|---|
| PubChem CID | 69171937 |
| Molecular Formula | C23H30FNO3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 1-[3-fluoro-2-(3-methylphenyl)phenyl]-5-methoxy-1-morpholin-2-ylpentan-1-ol |
| SMILES | COCCCCC(O)(c1cccc(F)c1-c1cccc(C)c1)C1CNCCO1 |
| InChI | InChI=1S/C23H30FNO3/c1-17-7-5-8-18(15-17)22-19(9-6-10-20(22)24)23(26,11-3-4-13-27-2)21-16-25-12-14-28-21/h5-10,15,21,25-26H,3-4,11-14,16H2,1-2H3 |
| InChIKey | VWAXSMKTJZOQNE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|