C18H28FNO2 — CID 67193967
(1S)-1-(2-fluoro-3-methylphenyl)-5-methoxy-1-piperidin-3-ylpentan-1-ol (PubChem CID 67193967) has the molecular formula C18H28FNO2 and a molecular weight of 309.42 g/mol. Its IUPAC name is (1S)-1-(2-fluoro-3-methylphenyl)-5-methoxy-1-piperidin-3-ylpentan-1-ol.
| Compound Name | (1S)-1-(2-fluoro-3-methylphenyl)-5-methoxy-1-piperidin-3-ylpentan-1-ol |
|---|---|
| PubChem CID | 67193967 |
| Molecular Formula | C18H28FNO2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (1S)-1-(2-fluoro-3-methylphenyl)-5-methoxy-1-piperidin-3-ylpentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1cccc(C)c1F)C1CCCNC1 |
| InChI | InChI=1S/C18H28FNO2/c1-14-7-5-9-16(17(14)19)18(21,10-3-4-12-22-2)15-8-6-11-20-13-15/h5,7,9,15,20-21H,3-4,6,8,10-13H2,1-2H3/t15?,18-/m0/s1 |
| InChIKey | JXVDUIVHSUJBQV-PKHIMPSTSA-N |
| XLogP | 3.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|