C13H16Cl2FN — CID 112564829
3-[1-(2,3-dichlorophenyl)-1-fluoroethyl]piperidine (PubChem CID 112564829) has the molecular formula C13H16Cl2FN and a molecular weight of 276.18 g/mol. Its IUPAC name is 3-[1-(2,3-dichlorophenyl)-1-fluoroethyl]piperidine.
| Compound Name | 3-[1-(2,3-dichlorophenyl)-1-fluoroethyl]piperidine |
|---|---|
| PubChem CID | 112564829 |
| Molecular Formula | C13H16Cl2FN |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-[1-(2,3-dichlorophenyl)-1-fluoroethyl]piperidine |
| SMILES | CC(F)(c1cccc(Cl)c1Cl)C1CCCNC1 |
| InChI | InChI=1S/C13H16Cl2FN/c1-13(16,9-4-3-7-17-8-9)10-5-2-6-11(14)12(10)15/h2,5-6,9,17H,3-4,7-8H2,1H3 |
| InChIKey | HOKRMTNDCPDCCX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |