C13H16BrF2N — CID 112564899
3-[1-(5-bromo-2-fluorophenyl)-1-fluoroethyl]piperidine (PubChem CID 112564899) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is 3-[1-(5-bromo-2-fluorophenyl)-1-fluoroethyl]piperidine.
| Compound Name | 3-[1-(5-bromo-2-fluorophenyl)-1-fluoroethyl]piperidine |
|---|---|
| PubChem CID | 112564899 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-[1-(5-bromo-2-fluorophenyl)-1-fluoroethyl]piperidine |
| SMILES | CC(F)(c1cc(Br)ccc1F)C1CCCNC1 |
| InChI | InChI=1S/C13H16BrF2N/c1-13(16,9-3-2-6-17-8-9)11-7-10(14)4-5-12(11)15/h4-5,7,9,17H,2-3,6,8H2,1H3 |
| InChIKey | RSZLKNFHCWWANB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |